Answer:
coordination number
Explanation:
Coordination number -
In a crystal lattice , the number of atoms that are surrounded to a particular atom , is referred to as the coordination number of the crystal.
In the field of crystallography and chemistry , it is also called the ligancy.
In coordination chemistry , the number of ligands attached to the central metal atom is also known as the coordination number of the coordination compound.
Hence, from the given statement of the question,
The correct term is coordination number.
The correct answer is 30 seconds
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Answer:
0.1g (Gallon) of chlorine
Explanation:
<u>Formula</u>
1 gallon = 3.7L; the density of water is 1.0g/ml
<u>Given</u>
2g (gallon) of chlorine to sanitize = 1,000,000g (gallon) of water
<u>Solve</u>
If 2g (gallon) chlorine = 1,000,000g (gallon)
∴, ? chlorine = 40,000
The First step; set up an equation
1000000/2 = 40000/?
The Next step; divide 1 million to 2
1000000 ÷ 2 = 500000
Then, divide the result by 40000
40000 ÷ 500000 = 0.08
In the nearest unit that is 0.1
Therefore, it will take 0.1g (gallon) of chlorine to sanitize a 40,000-gallon pool.