Answer:
1.78 × 10⁹ μg
Explanation:
We have to convert 1.78 kg to μg.
Step 1: Convert 1.78 kilograms to grams
We will use the conversion factor 1 kg = 10³ g.
1.78 kg × 10³ g/1 kg = 1.78 × 10³ g
Step 2: Convert 1.78 × 10³ grams to micrograms
We will use the conversion factor 1 g = 10⁶ μg.
1.78 × 10³ g × 10⁶ μg/1 g = 1.78 × 10⁹ μg
Answer: 6.02214076 atoms Ca
Explanation:
Ca is monoatomic, so atoms in 1 mol = avogadro number
Schrodinger developed a famous equation that allows the solutions for electron wave functions to be found given a specific potential. For the case of an atom, Schroginger's equation allows the determination of electron wave functions. These wave functions tell us how electrons are distributed in space around the atom.
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Reconstitution is the act of adding fluid such as distilled water to a powdered or crystalline form.
Additionally, medications are frequently provided in dry form, such as powders or crystals, which must be reconstituted with liquid before being injected parenterally. To create a specified liquid concentration, a dry ingredient is reconstituted by adding a liquid diluent. To ensure that the drug is reconstituted in the exact concentration, it is crucial to carefully follow the reconstitution instructions. The quantity of fluid used to dilute the drug must also be taken into account when determining the dosage of reconstituted medication to provide to the patient.
Learn more about Reconstitution here-
brainly.com/question/791594
#SPJ4
