In the context of chemistry, yes. Energy input is always equal to the energy output.
The density of the sample is:
Density = mass / volume
Density = 9.85 / 0.675
Density = 14.6 g/cm³
If the sample has 95% gold, and 5% silver, its density should be:
0.95 x 19.3 + 0.05 x 10.5
Theoretical density = 18.9 g/cm³
The difference in theoretical and actual densities is very large, making it likely that the jeweler was not telling the truth.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Assuming that the reaction from A and C to AC5 is only
one-step (or an elementary reaction) with a balanced chemical reaction of:
<span>A + 5 C ---> AC5 </span>
Therefore the formation constant can be easily calculated
using the following formula for formation constant:
Kf = product of products concentrations / product of reactants
concentration
<span>Kf = [AC5] / [A] [C]^5 </span>
---> Any coefficient from the balanced chemical
reaction becomes a power in the formula
Substituting the given values into the equation:
Kf = 0.100 M / (0.100 M) (0.0110 M)^5
Kf = 6,209,213,231
or in simpler terms
<span>Kf = 6.21 * 10^9 (ANSWER)</span>
Answer:
1. Nuts
2. Canned meats and seafood
3. Dried grains
4. Dark chocolate
5. Protein powders
