Answer:
CaCO3 is the limiting reactant
55 g of CO2 is made
Explanation:
First we must put down the reaction equation;
CaCO3(s) + 2HCl(aq) ---------> CaCl2(s) + H2O(l) + CO2(g)
Number of mole of CaCO3 = 125g/100gmol-1 = 1.25 moles
From the reaction equation;
1 mole of CaCO3 yields 1 mole of CO2
Hence 1.25 moles of CaCO3 yields 1.25 moles of CO2
For HCl;
number of moles of HCl = 125g/36.5 g mol-1 = 3.42 moles
From the reaction equation;
2 moles of HCl yields 1 mole of CO2
3.42 moles of HCl yields 3.42 * 1/2 = 1.71 moles of CO2
Hence CaCO3 is the limiting reactant.
Mass of CO2 produced = 1.25g * 44 gmol-1 = 55 g of CO2
Yes mitochondria does make necrssary chemicals for the cell therefore the answer to your question is yes
Phosphorus!!!! Hope this helps
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
It depends, for example, it is quite important to know the Kelvin scale (i.e 0 degrees Celsius is 273 K and -273 degrees Celsius is 0 K ) when dealing gases. But I don't know other situations where you would need to know other temperature scales.
Hope this helps and also if you are using Fahrenheit 1 Fahrenheit is -17.22 degrees Celsius
