Answer:
Mass and gravitational for e is not relart
Answer:

Explanation:
They gave us the masses of two reactants and asked us to determine the mass of the product.
This looks like a limiting reactant problem.
1. Assemble the information
We will need a chemical equation with masses and molar masses, so, let's gather all the information in one place.
Mᵣ: 239.27 32.00 207.2
2PbS + 3O₂ ⟶ 2Pb + 2SO₃
m/g: 2.54 1.88
2. Calculate the moles of each reactant

3. Calculate the moles of Pb from each reactant

4. Calculate the mass of Pb

2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
0.72 mole of oxygen would produce 320.4 kJ of heat.
<u>Explanation:</u>
CH₄ (g) + 2O₂ (g) → CO₂ (g) + 2H₂O (ℓ) + 890kJ
According to the equation,
2 moles of O₂ produces 890 kJ of heat
So, 0.72 moles of O₂ will produce:

Therefore, 0.72 mole of oxygen would produce 320.4 kJ of heat.
Answer:
D. Kb = 1.8 × 10⁻⁵
Explanation:
The strongest base has the largest Kb value.
The largest Kb value has the smallest negative exponent.
So, the strongest base has Kb = 1.8 × 10⁻⁵.