There are three ways of abrasion occurs in nature; the wind, waves, and gravity. Abrasion is the mechanical process of wearing away of a rock surface and the movement of the particles while transporting through the wind, waves, and gravity.
Carbon is the one and only element to make a molecule organic.
Answer: Sunlight passes through the atmosphere and warms the Earth's surface. ... As more greenhouse gases are emitted into the atmosphere, heat that would normally be radiated into space is trapped within the Earth's atmosphere, causing the Earth's temperature to increase.
Explanation: This keeps well life on earth so the answer is (3)
:)
The answer is (3) The average velocity of the gas molecules increases. In the closed rigid cylinder, the volume of the gas and number of gas molecules will not change. The number of collision will increase.
Answer:
6 moles of oxygen
Explanation:We can find from the chemistry equation
C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)
6 moles O2 ~4 moles H2O
