Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
C. 4 decorated cupcakes.
Because 12 divided by 3 = 4, so you can have 4 cupcakes each with 3 cherries
Plants most commonly break large rock into smaller pieces by having the plant root grow into cracks in rocks. The plant root from below the surface grows and that's how they break rocks into pieces.
a laboratory for research in chemistry. chem lab, chemistry lab. lab, laboratory, research lab, research laboratory, science lab, science laboratory - a workplace for the conduct of scientific research.
Biosphere. it is a place where plant's and animals live together and they r interconnected to eachother
