The 3 common gases that give off reactions are Hydrogen sulfide, Carbon monoxide, Nitrogen oxides.
<h3>What are off reactions</h3>
Off reactions are defined as chemical reactions that occurs when something burns or during combustion of materials which gives off energy.
Some gases that give off reaction are:
- Hydrogen sulfide
- Carbon monoxide
- Nitrogen oxides
Note that these gases are mostly poisonous.
Therefore, the 3 common gases that give off reactions are Hydrogen sulfide, Carbon monoxide, Nitrogen oxides.
Learn more about off reactions here:
brainly.com/question/16416932
#SPJ12
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
200 calories.
Explanation:
The (latent) heat of fusion of a material, is either one of:
1) the heat required to melt the material without
temperature change or
2) the heat removed from the material to freeze it
without temperature change.
For water this latent heat is 80 cal/g. Multiply this by
2.5 g to get 200 cal.
Answer:
A scientific question is basically a question that can lead to a hypothesis to help us figure out the observation in science. I hope this helps you
Both b and c for the vertical clomns
