In order for a solute to dissolve in a solvent,
the attractive forces between solute particles and the solvent particles must
be stronger than the attractive forces between solute-solute and
solvent-solvent particles. This is important so that the solute will remain in
solution.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
living organisms whose genetic material has been artificially manipulated in a laboratory through genetic engineering
Explanation:
Answer: 10L
Explanation:
Given that:
Initial pressure P1 = 1 atm
New pressure P2 = 3 atm
Initial volume V2 = 30 L
New volume V2 = ?
Since pressure and volume are involved, apply the formula for Boyle's law
P1V1 = P2V2
1 atm x 30L = 3 atm x V2
30 atm L = 3 atm x V2
V2 = (30 atm L / 3 atm)
V2 = 10L
Thus, volume changed to 10 liters
