Answer:
Explanation:
In a saturated solution, more solute cannot be dissolved at a given temperature.
This is because, the solute dissolves in a solvent because of space between particles of solvent but on continuous addition of solute, the space between the solvent particles gets fulfilled. Thus no more solute particle can dissolve in a solvent.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
B is the answer to ur question
Particles below the surface of a liquid
