Answer:
b. primitive cubic < body-centered cubic < face-centered cubic
Explanation:
The coordination number is defined as <em>the number of atoms (or ions) surrounding an atom (or ion) in a crystal lattice</em>. Its value gives us a measure of how tightly the spheres are packed together. The larger the coordination number, the closer the spheres are to each other.
- In the <u>primitive cubic</u>, each sphere is in contact with 6 spheres, so its <u>coordination number is 6</u>.
- In the <u>body-centered cubic</u>, each sphere is in contact with 8 spheres, so its <u>coordination number is 12</u>.
- In the <u>face-centered cubic</u>, each sphere is in contact with 12 spheres, so its <u>coordination number is 12</u>.
Therefore, the increasing order in density is the primitive cubic first, then the body-centered cubic, and finally the face-centered cubic.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
It has two elements.
Magnesium shows +2and Cl shows -1.