Answer:
C
) 2, 1, 2
Explanation:
The given reaction is synthesis reaction in which lithium and bromine react to form lithium bromide.
Chemical equation:
Li + Br₂ → LiBr
Balanced chemical equation:
2Li + Br₂ → 2LiBr
Step 1:
Li + Br₂ → LiBr
left hand side Right hand side
Li = 1 Li = 1
Br = 2 Br = 1
Step 2:
Li + Br₂ → 2LiBr
left hand side Right hand side
Li = 1 Li = 2
Br = 2 Br = 2
Step 3:
2Li + Br₂ → 2LiBr
left hand side Right hand side
Li = 2 Li = 2
Br = 2 Br = 2
The kidneys will excrete increased quantities of acid.
Explanation:
The kidneys will excrete excess H+ ions in the blood (remember H+ ions are responsible for acidity) until the acid-base balance is restored in the blood. Bicarbonates, on the other hand, will be aggressively reabsorbed by the renal tubules as the excess H+ are being excreted.
The acid base balance is mainly determined by the quantities of H⁺ and HCO₃⁻ ions in teh blood. These ions come from the dissociation of carbonic acid formed when carbon dioxide from tissues is dissolved in blood plasma.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
The lewis structure is helpful in showing how the bonding between atoms of a molecule are. The lewis structure of ammonia would be that the nitrogen atom will share three pairs of electron with the three hydrogen atoms leaving nitrogen to have 1 lone pair.<span />
