Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
D. a reactant that is catalyzed by an enzyme
Explanation:
um
search engime
Answer:
No. 3 lithium
Explain that lithium has 3 protons and 3 electrons. There are 2 electrons on the first energy level and 1 electron on the second
No. 4 Hydrogen (H) and helium (He) have a valence shell containing one and two electrons respectively. They make up the first period (row) of the periodic table. Their valence electron/s are in the first energy level (n=1) , as is denoted by 1s1 and 1s2 .
<em>That</em><em>'</em><em>s</em><em> </em><em>all</em><em> </em><em>i</em><em> </em><em>dont</em><em> </em><em>know</em><em> </em><em>if</em><em> </em><em>this</em><em> </em><em>is</em><em> </em><em>right</em><em> </em><em>though</em><em>.</em><em> </em>
40×19.32/100=7.7=8×2=16Ca
35.5×34.30/100=12.1=12×2=24Cl
16×46.38/100=7.4=7×2=14O
<span>after the 1940, the infention of : PASTEURIZATION permitted wines to be produced in places where climate was not ideal for wine production
after pasteurization process, all the microbes that exist within the wine are eliminated, which will prevent it from rottening. This make it possible to store wine for a long period of time even thought it's not in the harvesting climate</span>