All categories

3 years ago

A solution that has a high concentration of hydrogen ions has what type of pH?

2 answers:

7 0

A solution that has a high concentration of hydrogen ions has a pH value of 2. This means, the solution is very acidic and if one were to calculate the concentration of hydrogen ions, using the formula:

pH = -log(H+)

Given the concentration it would be low.

Degger [83]3 years ago

5 0

Given information:

A solution with a high H+ ion concentration

To determine:

The nature of pH of such a solution

Explanation:

pH is a measure of the H+ ion concentration in a given solution. Lower the pH higher will be the H+ concentration and the solution is termed acidic. In contrast, if the pH is higher the H+ concentration will be lower and the solution is basic.

Mathematically,

pH = -log[H+]

[H+] = $10^{-pH}$

pH = 2; [H+] = 10⁻²M

pH = 7; [H+] = 10⁻⁷M

pH = 13; [H+] = 10⁻¹³M

pH = 14; [H+] = 10⁻¹⁴M

Ans: (a)

Thus, the highest concentration of H+ ions is for a solution of pH = 2

You might be interested in

An upward force acts on a proton as it moves with a speed of 2.0 × 105 meters/second through a magnetic field of 8.5 × 10-2 tesl

mel-nik [20]

Explanation :

It is given that,

Speed of the proton, $v=2\times 10^{5}\ m/s$

Magnetic field, $B=8.5\times 10^{-2}\ T$

Magnetic force is given by :

$F=q(v\times B)$

q is the charge of proton, $q=1.6\times 10^{-19}\ C$

So,

$F=1.6\times 10^{-19}\ C\times 2\times 10^{5}\ m/s\times 8.5\times 10^{-2}\ T$

$F=2.72\times 10^{-15}\ N$

The direction of force is given by using right hand rule. So, the force will act in upward direction.

Hence, the correct option is (a) " $2.72\times 10^{-15}\ N$ to the north".

3 0

3 years ago

Read 2 more answers

Pb(NO3)2+K2CrO4=PbCrO4+KNO3 reaction type

Dmitry [639]

Precipitation reaction and double displacement reaction

7 0

2 years ago

Draw the organic and inorganic products for the following acid/base reaction as well as the charges.

Reptile [31]

The product would be :
H3O+ Benzaldehyde -----> C6H5CHO.
It will form a neutral molecule. So the charge is neutral.
I hope it helped.

8 0

3 years ago

3. If a sound is louder or a light is brighter, what does this mean about the amplitude of

hodyreva [135]

Answer: for 3. I would say it means that the amplitude is greater because if a sound is louder that means the amplitude is larger, same with the light.So that would mean the softer the sound the smaller the amplitude same with the dim of the light so for 4. It would be the amplitude is smaller. Hope this helps! :) ( if you have any questions feel free to ask)

7 0

3 years ago

The distance from Santa Maria to Los Alamos is 16.25 mi. what is the distance in meters?

Radda [10]

Answer:

26,167.47m

Explanation:

Problem:

We are to solve this problem using dimensional analysis:

from the given conversion factors-

0.621mi = 1.00km

1km = 1000m

From the problem, we are groing from miles to metres:

16.25mi x $\frac{1km}{0.621mi}$ x $\frac{1000m}{1km}$

The mi will cancel out and also the km. This leaves us with the desired unit we want which is meters, m.

= 26,167.47m

7 0

3 years ago