All categories

3 years ago

Consider the balanced equation for the following reaction:

Chemistry

1 answer:

wel3 years ago

4 0

Answer:

The amount of ammonia needed is 33.3 g

Therefore, we can also say 1.96 moles of NH₃

Explanation:

The reaction is: 3CuO(s) + 2NH₃(g) → 3H₂O(l) + 3Cu(s) + N₂(g)

If we see stoichiometry, 3 moles of water can be produced by 2 moles of NH₃. We propose this rule of three:

3 moles of water can be produced by 2 mole of ammonia

Then, 2.94 moles of water, must be produced by (2.94 . 2) /3 =1.96 moles of NH₃

If we convert the moles to mass. 1.96 mol . 17 g /1mol = 33.3 g

You might be interested in

A paint chip is placed in ethanol and curls what type of paint is it

Licemer1 [7]

Answer:

it is probably acrylic or latex

Explanation:

3 0

2 years ago

10. Write the formula for the compounds: copper (1) chloride and copper (II) chloride

Natali [406]

Answer:

Copper(II) chloride (CuCl2) reacts with several metals to produce copper metal or copper(I) chloride (CuCl) with oxidation of the other metal.

Explanation:

3 0

2 years ago

A student wants to compare how easily a metal and a plastic spoon of the same temperature can transfer thermal energy. Which of

Artist 52 [7]

Measure the effort required to bend each spoon.

5 0

2 years ago

Read 2 more answers

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

2 years ago

When circumstances are right, most materials undergo a process called thermal expansion. Which statement best describes the caus

harina [27]

Answer: Matter is heated, and its particles spread out more

Explanation:

Thermal expansion occurs when there's an expansion of an object or material or when an object becomes bigger because of a rise in its temperature. This brings about the faster movement of the heated molecules and the atoms spreading out.

Therefore, the cause and effect of thermal expansion will be that when matter is heated, and its particles spread out more.

6 0

3 years ago