Ask question

Ask question

All categories

Sunny_sXe [5.5K]

3 years ago

8

How many liters of methane gas (CH4) need to be combusted to produce 8.5 liters of water vapor, if all measurements are taken at

the same temperature and pressure? Show all of the work used to solve this problem. CH4 (g) + 2O2 (g) yields CO2 (g) + 2H2O (g)

1 answer:

zimovet [89]3 years ago

6 0

8.5L H2O (1 mol H2O/22.4L)=.37946 mol H2O
.3796 mol H2O(1 mol CH4/2 mol H2O)=.18973 mol CH4
.18973 mol CH4(22.4L/1mol CH4)=4.25L CH4 gas

You might be interested in

Please help! I really don’t understand it

chubhunter [2.5K]

Answer:

C. It makes sure there is a balance inside the body

Explanation:

Hope this helps

7 0

3 years ago

Read 2 more answers

Your job is to determine the concentration of ammonia in a commercial window cleaner. In the titration of a 25.0 mL sample of th

ruslelena [56]

Answer:

The initial concentration of ammonia is 0.14 M and the pH of the solution at equivalence point is 5.20

<u>Explanation:</u>

To calculate the number of moles for given molarity, we use the equation:

$\text{Molarity of the solution}=\frac{\text{Moles of solute}}{\text{Volume of solution (in L)}}$ .....(1)

Molarity of HCl solution = 0.164 M

Volume of solution = 23.8 mL = 0.0238 L (Conversion factor: 1 L = 1000 mL)

Putting values in equation 1, we get:

$0.164M=\frac{\text{Moles of HCl}}{0.0238L}\\\\\text{Moles of HCl}=(0.146mol/L\times 0.0238L)=0.0035mol$

The chemical equation for the reaction of ammonia and HCl follows:

$NH_3+HCl\rightarrow NH_4^++Cl^-$

By Stoichiometry of the reaction:

1 mole of HCl reacts with 1 mole of ammonia

So, 0.0035 moles of HCl will react with = $\frac{1}{1}\times 0.0035=0.0035mol$ of ammonia

Calculating the initial concentration of ammonia by using equation 1:

Moles of ammonia = 0.0035 moles

Volume of solution = 25 mL = 0.025 L

Putting values in equation 1, we get:

$\text{Initial concentration of ammonia}=\frac{0.0035mol}{0.025L}=0.14M$

By Stoichiometry of the reaction:

1 mole of ammonia produces 1 mole of ammonium ion

So, 0.0035 moles of ammonia will react with = $\frac{1}{1}\times 0.0035=0.0035mol$ of ammonium ion

Calculating the concentration of ammonium ion by using equation 1:

Moles of ammonium ion = 0.0035 moles

Volume of solution = [23.8 + 25] mL = 48.8 mL = 0.0488 L

Putting values in equation 1, we get:

$\text{Molarity of ammonium ion}=\frac{0.0035mol}{0.0488L}=0.072M$

To calculate the acid dissociation constant for the given base dissociation constant, we use the equation:

$K_w=K_b\times K_a$

where,

$K_w$ = Ionic product of water = $10^{-14}$

$K_a$ = Acid dissociation constant

$K_b$ = Base dissociation constant = $1.8\times 10^{-5}$

$10^{-14}=1.8\times 10^{-5}\times K_a\\\\K_a=\frac{10^{-14}}{1.8\times 10^{-5}}=5.55\times 10^{-10}$

The chemical equation for the dissociation of ammonium ion follows:

$NH_4^+\rightarrow NH_3+H^+$

The expression of $K_a$ for above equation follows:

$K_a=\frac{[NH_3][H^+]}{[NH_4^+]}$

We know that:

$[NH_3]=[H^+]=x$

$[NH_4^+]=0.072M$

Putting values in above expression, we get:

$5.55\times 10^{-10}=\frac{x\times x}{0.072}\\\\x=6.32\times 10^{-6}M$

To calculate the pH concentration, we use the equation:

$pH=-\log[H^+]$

We are given:

$[H^+]=6.32\times 10^{--6}M$

$pH=-\log (6.32\times 10^{-6})\\\\pH=5.20$

Hence, the initial concentration of ammonia is 0.14 M and the pH of the solution at equivalence point is 5.20

5 0

3 years ago

What is the molecular geometry if you have 3 single bonds and 1 lone pair around the central atom?

Elodia [21]

Answer:

There are 2 double bond units and 1 lone pair, which will try to get as far apart as possible - taking up a trigonal planar arrangement. Because the lone pair isn't counted when you describe the shape, SO2 is described as bent or V-shaped.

Explanation:

There are 2 double bond units and 1 lone pair, which will try to get as far apart as possible - taking up a trigonal planar arrangement. Because the lone pair isn't counted when you describe the shape, SO2 is described as bent or V-shaped.

7 0

3 years ago

Can someone help me I would really appreciate it

slega [8]

The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.

8 0

4 years ago

You wish to construct a buffer of pH=7.0. Which of the following weak acids (w/ corresponding conjugate base) would you select?

Alex17521 [72]

Answer:

C.) HOCl Ka=3.5x10^-8

Explanation:

In order to a construct a buffer of pH= 7.0 we need to find the pKa values of all the acids given below

we Know that

pKa= -log(Ka)

therefore

A) pKa of HClO2 = -log(1.2 x 10^-2)

=1.9208

B) similarly PKa of HF= -log(7.2 x 1 0^-4)= 2.7644

C) pKa of HOCl= -log(3.5 x 1 0^-8)= 7.45

D) pKa of HCN = -log(4 x 1 0^-10)= 9.3979

If we consider the Henderson- Hasselbalch equation for the calculation of the pH of the buffer solution

The weak acid for making the buffer must have a pKa value near to the desired pH of the weak acid.

So, near to value, pH=7.0. , the only option is HOCl whose pKa value is 7.45.

Hence, HOCl will be chosen for buffer construction.

3 0

3 years ago