Answer:
The correct option is;
d 4400
Explanation:
The given parameters are;
The mass of the ice = 55 g
The Heat of Fusion = 80 cal/g
The Heat of Vaporization = 540 cal/g
The specific heat capacity of water = 1 cal/g
The heat required to melt a given mass of ice = The Heat of Fusion × The mass of the ice
The heat required to melt the 55 g mass of ice = 540 cal/g × 55 g = 29700 cal
The heat required to raise the temperature of a given mass ice (water) = The mass of the ice (water) × The specific heat capacity of the ice (water) × The temperature change
The heat required to raise the temperature of the ice from 0°C to 100°C = 55 × 1 × (100 - 0) = 5,500 cal
The heat required to vaporize a given mass of ice = The Heat of Vaporization × The mass of the ice
The heat required to vaporize the 55 g mass of ice at 100°C = 80 cal/g × 55 g = 4,400 cal
The total heat required to boil 55 g of ice = 29700 cal + 5,500 cal + 4,400 cal = 39,600 cal
However, we note that the heat required to vaporize the 55 g mass of ice at 100°C = 80 cal/g × 55 g = 4,400 cal.
The heat required to vaporize the 55 g mass of ice at 100°C = 4,400 cal
Answer: Fundamental, Key, vital, crucial
Explanation:
Sound can be used to alert us in emergencies. 2. Sound can also be used to help blind people navigate the world better. I’m sorry if these horrible but I tried lol
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
<span>The pressure inside a coke bottle is really high. This helps keep the soda carbonated. That is, the additional pressure at the surface of the liquid inside the bottle forces the bubbles to stay dissolved within the soda. </span><span>When the coke is opened, there is suddenly a great pressure differential. The initial loud hiss that is heard is this pressure differential equalizing itself. All of the additional pressure found within the bottle pushes gas out of the bottle until the pressure inside the bottle is the same as the pressure outside the bottle. </span><span>However, once this occurs, the pressure inside the bottle is much lower and the gas bubbles that had previously been dissolved into the soda have nothing holding them in the liquid anymore so they start rising out of the liquid. As they reach the surface, they pop and force small explosions of soda. These explosions are the source of the popping and hissing that continues while the soda is opened to the outside air. Of course, after a while, the soda will become "flat" when the only gas left dissolved in the liquid will be the gas that is held back by the relatively weak atmospheric pressure.</span>
