Answer:
According to libretexts the answer would be B. decreases.
Explanation:
If the hydrogen concentration increases, the pH decreases, causing the solution to become more acidic. This happens when an acid is introduced. ... If the hydrogen concentration decreases, the pH increases, resulting in a solution that is less acidic and more basic
Elements in group 1-2, 13-18, the number of valence electrons is related to the group number. For example, in the first group, the alkali metals there is one valence electron, however in group 13, there are 3 valence electrons. Valence electrons are also known as the outershell electrons.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
The vapors of some chemicals used in the chemistry laboratory, especially isocyanates, can react and bond the contact lens to the eye.
(FYI - the family of isocyanates include Superglue..I wouldn't want to have been the person who discovered this unfortunate reaction!)
Answer:
See explanation
Explanation:
We know that photosynthesis involves the combination of carbon dioxide and water in the presence of sunlight to yield glucose.
If the atmosphere is rich in carbon dioxide such as in a green house where air is filled with carbon dioxide, the rate of photosynthesis is increased.
As the rate of photosynthesis is increased, the growth of plants is also increased.
Hence, in a greenhouse where the air contains more carbon dioxide, the rate of plant growth increases.
