<span>Molecular formulas tell you how many atoms of each element are in a compound, and empirical formulastell you the simplest or most reduced ratio of elements in a compound. ... Also, many compounds with different molecular formula have the same<span>empirical formula</span></span>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
15 ml
Explanation:
Volume = mass / density.
So our answer is 15 / 3 = 15 mL
Answer:
178.01347 ± 0.00093 g/mol
Explanation:
The element that is used as a rat poison and found of the murder mystery is Arsenic.
Hope this helped you!
