Answer:
%age Yield = 85.36 %
Solution:
The Balance Chemical Reaction is as follow,
C₆H₁₂O + Acid Catalyst → C₆H₁₀ + Acid Catalyst + H₂O
According to Equation ,
100 g (1 mole) C₆H₁₂O produces = 82 g (1 moles) of C₆H₁₀
So,
4.0 g of C₆H₁₂O will produce = X g of C₆H₁₀
Solving for X,
X = (4.0 g × 82 g) ÷ 100 g
X = 3.28 g of C₆H₁₀ (Theoretical Yield)
As we know,
%age Yield = (Actual Yield ÷ Theoretical Yield) × 100
%age Yield = (2.8 g ÷ 3.28 g) × 100
%age Yield = 85.36 %
The amount of absorption force is not same at all time and at all where .
It has difference at different time periods
So during those the curve goes up and down and repeat this flow
So there are dips
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
The monomers that react together to form polyurethane polymer are diisocyanate and diol.
<h3>
What are polymers?</h3>
- Polymers are a class of natural or synthetic substances
- It is made up of small units called monomers arranged in a repeated pattern to form large molecules called macromolecules
- Cellulose and resins are examples of natural polymers
- Polyethylene and polychloroprene are examples of synthetic polymers.
Polyurethane polymer is made up of monomers diisocyanate and diol. It is mostly used in home furnishing in flexible form. The structures of monomers are as follows:
Learn more about polymers:
brainly.com/question/17638582
#SPJ4
Answer:
Distance of something it can be any type of distance
