You take 16 and -5 and subtract them to get the answer which is 11
Answer:
a. The total length of cloth that the dressmaker bought.
b. 2/5 m, 1/3 m, 1/6 m
c. Addition of fractions
Step-by-step explanation:
Step 1. Get the LCD or least common denominator which is in this case 30.
Step 2. Transform each fraction into similar fractions having the same denominator.
12/30, 10/30, 5/30
Step 3. Add now the similar fractions and simplify to lowest terms
27/30 ÷3 = 9/10
I hope it helps :)
Vas happenin
Hope you having a good day
I think it’s A
Hope this help *smiles*
In the first equation, moving 2x over gives "y = -2x-11". Placing this into the second equation gives "3x - 4(-2x-11) = 11", or "3x+8x+44 = 11", which can be reduced to "11x= -33" or "x = -3". Replacing the "x" with -3 in the first equation gives "-6 + y = -11" or "y = -5". This gives a solution of (-3, -5), or answer C.
Sin(a+b)=sin(a)cos(b)+cos(a)sin(b).
Let a=42 and b=17 so sin(42+17)=sin59.
