Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Weathering is the process of breaking large rocks and boulders into much smaller ones. Weathering can be brought about by wind and water mostly. Sometimes even biological forces account for some types of weathering.
Aluminum. chemical element with symbol Al
Answer:
Chemical reactivity increases down a group and decreases from left to right of a period.
Explanation:
The higher the ionization energy is, the lower the reactivity is. Since the ionization energy is highest in the top right corner of the periodic table, we can assume that the most reactive elements are in the opposite bottom left corner. This is because the electrons that react are farther away from the nucleus thus experience less attraction to the nucleus (called nuclear shielding). Therefore their electrons are more easily removed than elements that don't ecperience nuclear shielding.
Chemical reactions involve electrons and where they move (if they move).
Metal atoms (or elements) usually give away their outer shell electrons in reactions to become stabilised (creating positive ions). Non-metal atoms (or elements) usually gain electrons in order to become stable (negative ions). Some reactions involve covalent bonds, metallic bonds, ionic bonds etc., but at the base (no pun intended :D) of most chemical reactions it's just a matter of electrons moving around between atoms.
Hope it helps!