Well there are plenty of benefits and consequences.
But one would be the ability to do certain tasks without actually having to do them. A consequence could be on the environment. For example, the use of a car plays a big part on the environment involving smog.
Hope this helps!
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Mass is 725.46g/cm
Explanation:
Mass = density × volume = 22.6g/cm^3 × 32.1cm^2 = 725.46g/cm
<span>If a neutral atom becomes negatively charged, it has undergone reduction.
Reduction is the process through which a neutral atom gain an electron (thus reducing its oxidation number) and turns into a negative ion (also known as : anion)</span>
Frost wedging happens when water gets in crack, freezes, and expands. This process breaks rocks apart. When this process is repeated, cracks in rocks get bigger and bigger and may fracture, or break, the rock.
Hope this helps :)
