The chemical bonds in CH4 are all single bonds. C only can bond 4 times because it needs 8 electrons in it's outer shell and only has four right now. The bonds represented are all single bonds because there are two electrons present on each side of the carbon. Two electrons, in this case, equals one bond.
Answer:
C
Explanation:
okay, you need to look at the structures of the particles of matter in the solid, liquid and gas.
- particles in a solid are in fixed positions, where they can only vibrate in those positions ( take a look at ice, or rather, a brick)
- liquids have very small or rather, no spaces between them, but they can slide or rub against each other, like people in a <em>really tight</em> crowd I guess
- gas particles have very large spaces between them and they move randomly. these exibit what's called brownian motion.
- since water particles (and all other liquid particles) have negligible spacings and limited movement, that allows the dye particles to move from a region of high concentration to that of a low concentration. the aim for this is for the mixture/solution to reach an equilibrium, that is the mixture must get to a point where all regions have the same concentration of the dye.
you can refer to your coursebooks :)
correct where wrong please:)
Answer:
Hydrogen is an element
Explanation:
Hydrogen is an element with only hydrogen atoms, whereas air, carbon dioxide, and water are all made up of multiple elements with different types of atoms.
Answer:
The correct answer is - they can create genetic diversity as well and reproduce without mate when necessary.
Explanation:
Sexual reproduction provides an organism with genetic diversity and variation by the process and it required two mates and a longer time to pollination and fertilization and is used in normal conditions.
In case of a threat, such organisms use asexual reproduction to increase their number as in asexual reproduction no need of mate, an organism can grow and increase on its own it provides to not to exitinct.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
