The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
The classification of it being a metal, nonmetal, or metalliod will be useful in the process of elimination to determine what it is. Then for the second test, meauring the atomin radius will narrow it down quicker to the mystery elemet's name.
Since you determined what part of the periodic table it's on, then when measuring the atomic radius, you should be able to pinpoint what the element is more surely.
Answer:
umm ok lol thx for the f r e e points
I believe it is B... because all balance equation are supposed to follow the law of conservation of mass
