Oxidation reaction
In ---> In³⁺ + 3e ---1)
reduction reaction
Cd²⁺ + 2e ---> Cd ---2)
when balancing the reactions, electrons have to be balanced. to balance the electrons multiple 1st reaction by 2 and 2nd reaction by 3
1) x 2
2) x 3
2In ---> 2In³⁺ + 6e
3Cd²⁺ + 6e ---> 3Cd
add the 2 equations to obtain the overall reaction
2In + 3Cd²⁺ ---> 2In³⁺ + 3Cd
<span>Blood pH has an ideal level of about 7.3 to 7.4. It is important for the pH ofblood to remain constant because if your blood pH varies, itcan be deadly.<span>hope this helps </span></span>
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
I believe the answer is A. However, I would double check the formula.
At 3.5s the distance would be 10.85
Find 1/4th of 2.00 and add that to 6.2