Answer
Avogadro's number: One mole of any substance contains 6.022×10²³ molecules
Explanation
While finding the number of moles of oxygen molecules present in 3.65 moles of Na2SO4 the conversion factor used would be Avodagro's number, which is
One mole of any substance contains 6.022×10²³ molecules.
Yes because the sun will make alots of thing grow
Answer: Within each element square, information on the element's symbol, atomic number, atomic mass, electronegativity, electron configuration, and valence numbers can be found. At the bottom of the periodic table is a two row block of elements that contain the lanthanoids and actinides.
Answer: False
Explanation:
Since the given equation is not balanced properly.
Since oxygen and hydrogen atoms are not balanced.
There should be 6 H2O (g) molecules and 14 mol H2 (g)
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
