All categories

3 years ago

Are Zombies Living or Non-living Reasoning and Evidence?

Chemistry

1 answer:

Thepotemich [5.8K]3 years ago

7 0

Answer:

I believe that zombies are not living

Explanation:

because zombies don't grow and develop because they are practically mindless. Also, zombies definitely respond to the environment (like when they see a human) but they don't adapt to it

You might be interested in

What is the percent composition of hydrogen in vinegar (CH3COOH)?

barxatty [35]

Answer:

%H = 6.72 %

Explanation:

Percent composition of an element is the total mass of that element divided by the molecular mass of compound (or molecular mass) of which it is present in.

So,

Percent composition of Hydrogen will be given as,

%H = Total mass of H / Molecular Mass of Acetic Acid × 100

So,

Total Mass of H = 1.01 × 4 = 4.04 g

Molecular Mass of Acetic acid = 60.052 g/mol

Putting values in above formula,

%H = 4.04 g/mol ÷ 60.052 g/mol × 100

%H = 6.72 %

6 0

3 years ago

What is the purpose of the scientific method? ON APEX LEARNING

Arturiano [62]

The purpose of the scientific method "to use an experiment to test a scientific theory".

Answer: Option C

Explanation:

Researchers use the scientific method when conducting experiments to collect observable, empirical data in a hypothesis-related experiment , the findings that tend to justify or oppose a theory. It's also very important that other researchers can repeat and independently verify the conclusions, logic, and experiments.

Scientific method retains inductive reasoning its position. Scientists use this to formulate theories and hypotheses. In order to adapt the ideas to particular situations, deductive reasoning allows them to do so. Overall scientific methods have become path of analyzing different processes, going in our environment.

4 0

3 years ago

Read 2 more answers

Determine the value of the equilibrium constant, Kgoal, for the reaction

hodyreva [135]

Answer:

Part A

$K_{goal}= 3.22\times 10 ^{-66}$

Part B

$K_{goal}= 2.26\times10^{-21}$

Explanation:

Part A:

The given equation is not balanced. So, initially let's balance the equation by taking 24 moles of each of the reagent and NO.

24N₂ + 24H₂O ⇌ 24NO + 12N₂H₄

Now, simplify the equation by dividing both sides by 12. The final balanced equation is the following

2N₂ + 2H₂O ⇌ 2NO + N₂H₄

The above-balanced equation can be solved algebraically to obtain the required Kgoal value.

Adding given equations 1, 2 and 3 we obtain the required equation.

When the equations are added, the equilibrium constants of each equation are multiplied. Mathematically it can be represented as,

$K_1 \times K_2 \times K_3 = K_{goal}$

$K_{goal}= 4.10 \times 10^{-31} \times 7.40 \times 10^{-26} \times 1.06 \times 10^{-10}$

$K_{goal}= 3.22\times 10 ^{-66}$

Part B:

The required equation is balanced, Now

Let.

P₄(s)+6Cl₂(g) ⇌ 4PCl₃(g), K₁=2.00×10¹⁹ ------------------------------------ (a)

PCl₅(g) ⇌ PCl₃(g)+Cl₂(g), K₂=1.13×10⁻² --------------------------------------- (b)

By multiplying equation 2 by 4 and subtracting equation 1 from it, we get

4PCl₅(g) ⇌ P₄(s)+10Cl₂(g)

The Kgoal for the above equation is the product of four times K₂ and inverse K₁ according to the applied operation. Mathematically,

$K_{goal}= 4K_2 \times \frac{1}{K_1}$

$K_{goal}= 4(1.13\times10^{-2}) \times \frac{1}{2.00\times10^{19}}$

$K_{goal}= 2.26\times10^{-21}$

5 0

3 years ago

Give an example of something that is observable but does not contain matter. Explain.

ale4655 [162]

The best example I can give that is observable but does not contain matter is:

sunlight or simply light

Light does not contain matter because it is a beam of energy or to be specific made up of packet of photons.

6 0

3 years ago

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

3 years ago