A cylinder is labeled \"PENTANE.\" When the gas inside the cylinder is monochlorinated, five isomers of formula C5H11Cl result.

Chemistry

1 answer:

algol132 years ago

5 0

D) a mixture of two or all three of these

Explanation:

If a gas is contained in a cylinder labelled pentane, when it undergoes a monochlorination reation, five isomers of the derivative C₅H₁₁Cl will be produced because the cylinder is made up of a mixture of two or all three of the forms of pentane.

n-pentane will produce three isomeric monochlorides when monochlorinated.
isopentane will yields four isomeric monochlorides when monochlorinated.
neopentane produce just one monochloride.
None of the different isomer can give five isomers at a go. Therefore, the gas in the cylinder is a mixture of two or all three types of pentane that has been listed.

Learn more:

substitution reaction brainly.com/question/11220194

isomers brainly.com/question/4625349

#learnwithBrainly

You might be interested in

PLEASE HELP !!!! This is a models of chemistry question

lora16 [44]

Answer:

The 2.8 hrs one i think???

hope this helps

Explanation:

7 0

2 years ago

Leah is trying to determine how music affects the growth of plants. She hypothesizes that classical music will cause a plant to

Pani-rosa [81]

Leah's experiment:
A. Takes careful and regular measurements (she measures the growth every day)
B. Has a specific hypothesis and a controlled experiment (the music is the only changing variable, the growth conditions are identical, and this is what she wants to test in her hypothesis)
C. Experimental data that can be recorded and analyzed (measuring the growth of plant fits this)

So the answer must be D, since there is no mention of past research that scientists have found on this topic.

8 0

3 years ago

Read 2 more answers

Which product(s) would be obtained by the dehydration of 2-heptanol? of 2-methyl-l-cyclohexanol?

Komok [63]

Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O

5 0

3 years ago

Which one of the following items does NOT characterize a reducing agent? a. A reducing agent loses electrons. b. A reducing agen

Ad libitum [116K]

Answer: D

Explanation:

A reducing agent is a species that reduces other compounds, and is thereby oxidized. The whole compound becomes the reducing agent. In other words, of a compound is oxidized, then they are the reducing agent. On the other hand, if the compound is reduced, it is an ozidizing agent.

Since we have established that a reducing agent is the compound being oxidized, we know that A is not our answer. An oxidized compound is losing electrons. Choice A states exactly this.

For B, this is true as we have established this already.

C is also correct. Since a reducing agent loses electrons, it becomes more positive. This makes the oxidation number increase.

D would be our correct answer. It is actually a good oxidizing agent is a metal in a high oxidation state, such as Mn⁷⁺.

4 0

2 years ago

In which reaction does the oxidation number of hydrogen change? In which reaction does the oxidation number of hydrogen change?

dedylja [7]

Answer: The correct answer is $2Na(s)+2H_2O(l)\rightarrow 2NaOH(aq.)+H_2(g)$

Explanation:

Oxidation number is defined as the number which is given to an atom when it looses or gains electron. When an atom looses electron, it attains a positive oxidation state. When an atom gains electron, it attains a negative oxidation state.

Oxidation state of the atoms in their elemental state is considered as 0. Hydrogen is present as gaseous state.

For the given chemical reactions:

Reaction 1: $2HClO_4(aq.)+CaCO_3(s)\rightarrow Ca(ClO_4)_2(aq.)+H_2O(l)+CO_2 (g)$