Answer:
Mass = 24.36 g of N₂
Explanation:
The balance chemical equation for the decomposition of NaNO₃ is as follow;
2 NaN₃ → 2 Na + 3 N₂
Step 1: Find moles of N₂ as;
According to equation,
2 moles of NaNO₃ produces = 3 moles of N₂
So,
0.58 moles of NaNO₃ will produce = X moles of N₂
Solving for X,
X = 3 mol × 0.58 mol / 2 mol
X = 0.87 mol of N₂
Step 2: Calculate mass of N₂ as,
Mass = Moles × M.Mass
Mass = 0.87 mol × 28.01 g/mol
Mass = 24.36 g of N₂
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Metal is a conductor. it takes in heat very well. wood is an insulator. it takes in heat too, but less of it. this makes the wood handle cooler and the metal handle hot
The arrow shows that the bond between the chlorine atom and the fluorine atom is nonpolar. The electrons in the bond are pulled more strongly by the fluorine atom, and the chlorine atom is slightly positive.
Explanation:
- The bond between Chlorine and fluorine is nonpolar bonding because both of them are sharing an equal number of electrons in the bond. H2, F2, and CL2 are common examples of this.
- Chlorine and fluorine are electronegative molecules but Fluorine is above chlorine in the periodic table. Since fluorine is above Chlorine, fluorine has slightly highest electronegative nature compare to fluorine. This is the reason why Fluorine molecules are attracting electrons more than chlorine atoms. This making chlorine atoms slightly positive in Cl and F bonding.
