The correct option is A. To calculate the binding energy, you have to find the mass defect first. Mass defect = [mass of proton and neutron] - Mass of the nucleus The molar mass of thorium that we are given in the question is 234, the atomic number of thorium is 90, that means the number of neutrons in thorium is 234 - 90 = 144. The of proton in thourium is 90, same as the atomic number. Mass defect = {[90 * 1.00728] +[144* 1.00867]} - 234 Note that each proton has a mass of 1.00728 amu and each neutron has the mass of 1.00867 amu. Mass defect = [90.6552 + 145.24848] - 234 = 1.90368 amu. Note that the unit of the mass is in amu, it has to be converted to kg To calculate the mass in kg Mass [kg] = 1.90368 * [1kg/6.02214 * 10^-26 = 3.161135 * 10^-27 To calculate the binding energy E = MC^2 C = Speed of light constant = 2.9979245 *10^8 m/s2 E = [3.161135 * 10^-27] * [2.9979245 *10^8]^2 E = 2.84108682069 * 10^-10. Note that we arrive at this answer because of the number of significant figures that we used. So, from the option given, Option A is the nearest to the calculated value and is our answer for this problem.
there are spaces within the enzymes that is active. That active site allows substrates to join in. This helps the enzyme carry out the chemical reaction with the substrate.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3 This will be named 2,4-dimethylpentane
2Ag + H2O -----> Ag2O + 2H is the equation of the reaction between metal and steam. Silver reacts with water (steam) forming silver oxide and hydrogen gas. When the metals react with steam it produces the solid metal oxide and hydrogen gas. On the surface o metals, a protective layer of aluminium oxide is formed that keeps water away from the metal so we can say that silver oxide and hydrogen are formed from the reaction of silver metal and steam.
