Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
nuclear power--used to turn turbines...
fossil fuels--burned to provide energy that is....
renewable energy--energy that with come back after use
outlet--a device....
steam--nuclear reactors....
I'm not sure but I tried lol,lemme know if I'm wrong :D
212 ml of lead nitrate is required to prepare a dilute solution of 820.7 ml of lead nitrate.
Answer:
Option A.
Explanation:
Similar to Avagadro's law, there is another law termed as dilution law. As the product of volume and normality of the reactant is equal to the product of volume and normality of the product from the Avagadro's law. In dilution law, it will be as product of volume and concentration of the solute of the reactant is equal to the product of volume and concentration of solution.

So, as per the given question C1 = 5.45 M of lead nitrate and V1 has to be found. While C2 is 1.41 M of lead nitrate and V2 is 820.7 ml.
Then, 

So nearly 212 ml of lead nitrate is required to prepare a dilute solution of 820.7 ml of lead nitrate.
I dont understand life, for example, look at my username.
Answer:
A. More mass
C. Shorter distance between them
Explanation:
The two characteristics of a body experiencing greater gravitational force are that they have mass and a shorter distance between them.
This is conformity with Newton's law of universal gravitation.
The law states that "every object attracts one another with a force that is directly proportional to their masses and inversely proportional to the square of the distance between them".
This law implies that the more the mass of two bodies, the more the gravitational force of attraction. And that the shorter the square of the distance between them, the more the attraction.