Answer: a. 0.05mol/dm3
bi. 0.045mol/dm3
bii. 4.41g/dm3
c. 84.8%
Explanation:Please see attachment for explanation
Answer:
11.3 g of 
are produced from 36.0 g of 
Explanation:
1. The balanced chemical equation is the following:
2. Use the molar mass of the , the molar mass of the and the stoichiometry of the balanced chemical reaction to find how many grams of are produced:
Molar mass = 18
Molar mass = 17
Therefore 11.3 g of are produced from 36.0 g of
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
When heat is added to a substance, the molecules and atoms vibrate faster. As atoms vibrate faster, the space between atoms increases. The motion and spacing of the particles determines the state of matter of the substance. The end result of increased molecular motion is that the object expands and takes up more space.
hope this helps!!!!!!
