The resulting pressure of the gas after decreasing the initial volume from 2 L to 1 L is 3 atm.
<h3>What is
Boyle's Law?</h3>
According to the Boyle's Law at constant temperature, pressure of the gas is inversely proportional to the volume of that gas.
For the given question we use the below equation is:
P₁V₁ = P₂V₂, where
P₁ = initial pressure of gas = 1.5 atm
V₁ = initial volume of gas = 2 L
P₂ = final pressure of gas = ?
V₂ = final volume of gas = 1 L
On putting all these values on the above equation, we get
P₂ = (1.5atm)(2L) / (1L) = 3 atm
Hence required pressure of the gas is 3 atm.
To know more about Boyle's Law, visit the below link:
brainly.com/question/469270
I love you too funny I love you too
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
The total amount of heat required is the sum of all the sensible heat and latent heats involved in bringing the ice to a desired temperature and state. The latent heat of fusion and vaporization of water 333.55 J/g and 2260 J/g, respectively. Solving for the total amount of heat,
total amount of heat = 13.0 g (2.09 J/gC)(12) + 13(333.55 J/g) + 13.0 g (4.18 J/gC)(100 - 0) + (13.0 g)(2260 J/g) + (13 g)(2.01 J/g)(113-100)
= 39815.88 J
= 39.82 kJ
Answer:
Answer choice A
Explanation:
When an electron is transferred to another atom, both atoms involved become ions.
