Answer:
29.41% of Calcium and 47.04% of Oxygen
Explanation:
The percent composition of an atom in a molecule is defined as 100 times the ratio between the mass of the atom and the mass of the molecule.
The mass of the molecule of the problem (Ore) is 46.28g. That means the percent composition of Calcium is:
13.61g / 46.28g * 100 = 29.41% of Calcium
And percent composition of Oxygen is:
21.77g / 46.28g * 100 = 47.04% of Oxygen
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
How does methane gas affect the environment?
If methane leaks into the air before being used — from a leaky pipe, for instance — it absorbs the sun's heat, warming the atmosphere. For this reason, it's considered a greenhouse gas, like carbon dioxide.
Explanation:
Answer:
<h3>The answer is 30 cm³</h3>
Explanation:
The volume of a substance when given the density and mass can be found by using the formula
From the question
mass = 180 g
density = 6 g/cm³
We have
We have the final answer as
<h3>30 cm³</h3>
Hope this helps you
i don't understand but atoms are made of electrons an protons and neutrons..
