Answer:
there will a definite decrease in solute solution
Explanation:
acid reaction acting upon negative charge.
When atoms bond together to form molecules, they share or give electrons. If the electrons are shared equally by the atoms, then there is no resulting charge and the molecule is nonpolar.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Explanation:
In a chemical change through chemical reactions, a new kind of matter forms. When a paint is mixed together, a physical change has occurred and not a chemical change. The different color one perceives is just a mere overlap between the reflected white and red color which produces another hue.
Not all color changes infers a chemical reaction. A paint is a complex mixture on its own.
