All categories

3 years ago

If you do 40 J of work on an object move it to meters, you apply ____ newtons of force to the object

Chemistry

1 answer:

musickatia [10]3 years ago

5 0

You apply 40 newton’s because j and newton’s are the same i think.
maybe look up j to newton conversion

You might be interested in

In a metabolic pathway, succinate dehydrogenase catalyzes the conversion of succinate to fumarate. the reaction is inhibited by

Pani-rosa [81]

Competitive inhibitor

7 0

3 years ago

A titration of 25.0 mL of a solution of the weak base aniline, C6H5NH2, requires 25.67 mL of 0.175 M HCl to reach the equivalenc

Lorico [155]

Answer:

a. 0.180M of C₆H₅NH₂

b. 0.0887M C₆H₅NH₃⁺

c. pH = 2.83

Explanation:

a. Based in the chemical equation:

C₆H₅NH₂(aq) + HCl(aq) → C₆H₅NH₃⁺(aq) + Cl⁻(aq)

1 mole of aniline reacts per mole of HCl

Moles required to reach equivalence point are:

Moles HCl = 0.02567L ₓ (0.175mol / L) = 4.492x10⁻³ moles HCl = moles C₆H₅NH₂

As the original solution had a volume of 25.0mL = 0.0250L:

4.492x10⁻³ moles C₆H₅NH₂ / 0.0250L = 0.180M of C₆H₅NH₂

b. At equivalence point, moles of C₆H₅NH₃⁺ are equal to initial moles of C₆H₅NH₂, that is 4.492x10⁻³ moles

But now, volume is 25.0mL + 25.67mL = 50.67mL = 0.05067L. Thus, molar concentration of C₆H₅NH₃⁺ is:

[C₆H₅NH₃⁺] = 4.492x10⁻³ moles / 0.05067L = 0.0887M C₆H₅NH₃⁺

c. At equivalence point you have just 0.0887M C₆H₅NH₃⁺ in solution. C₆H₅NH₃⁺ has as equilibrium in water:

C₆H₅NH₃⁺(aq) + H₂O(l) → C₆H₅NH₂ + H₃O⁺

Where Ka = Kw / Kb = 1x10⁻¹⁴ / 4.0x10⁻¹⁰ =

2.5x10⁻⁵ = [C₆H₅NH₂] [H₃O⁺] / [C₆H₅NH₃⁺]

When the system reaches equilibrium, molar concentrations are:

[C₆H₅NH₃⁺] = 0.0887M - X

[C₆H₅NH₂] = X

[H₃O⁺] = X

Replacing in Ka formula:

2.5x10⁻⁵ = [X] [X] / [0.0887M - X]

2.2175x10⁻⁶ - 2.5x10⁻⁵X = X²

0 = X² + 2.5x10⁻⁵X - 2.2175x10⁻⁶

Solving for X:

X = -0.0015 → False solution. There is no negative concentrations.

X = 0.001477 → Right solution.

As [H₃O⁺] = X, [H₃O⁺] = 0.001477

Knowing pH = -log [H₃O⁺]

pH = -log 0.001477

7 0

3 years ago

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

3 years ago

The decomposition of SOCl2 is first-order in SOCl2. If the half-life for the reaction is 4.1 hr, how long would it take for the

qaws [65]

4.1 h = 14760 s

t 1/2 = ln 2 / k 

k = rate reaction = 4.97 x 10^-5 

ln 0.045 / 0.36 = - 4.97 x 10^-5 t 

2.08 = 4.97 x 10^-5 t 

t = 41839.9 s = 11 h 37 min 19 s

3 0

3 years ago

The energy E of the electron in a hydrogen atom can be calculated from the Bohr formula: E = R_y/n^2 In this equation R_y stands

Katarina [22]

Answer:

The wavelength of the line in the emission line spectrum of hydrogen caused by the transition of the electron for the given energy levels is $5.23\times 10^{-5} m$

Explanation:

Given :

The energy E of the electron in a hydrogen atom can be calculated from the Bohr formula:

$E=\frac{R_y}{n^2}$

$R_y=2.18\times 10^{-18} J$ = Rydberg energy

n = principal quantum number of the orbital

Energy of 11th orbit = $E_{11}$

$E_{11}=\frac{2.18\times 10^{-18} J}{11^2}=1.80\times 10^{-20} J$

Energy of 10th orbit = $E_{10}$

$E_{10}=\frac{2.18\times 10^{-18} J}{10^2}=2.18\times 10^{-20} J$

Energy difference between both the levels will corresponds to the energy of the wavelength of the line which can be calculated by using Planck's equation.

$E'=E_{10}-E_{11}=2.18\times 10^{-20} J-1.80\times 10^{-20} J$

$=E'=0.38\times 10^{-20} J$

$\lambda =\frac{hc}{E'}$ (Planck's' equation)

$\lambda = \frac{6.626\times 10^{-34} Js\times 3\times 10^8 m/s}{0.38\times 10^{-20} J}$

$\lambda = 5.2310\times 10^{-5} m\approx 5.23\times 10^{-5} m$

The wavelength of the line in the emission line spectrum of hydrogen caused by the transition of the electron for the given energy levels is $5.23\times 10^{-5} m$

3 0

3 years ago