Answer:
Forumula
XOH + HY = XY + H2O
Explanation:
Salt formed from: Salt Solution
Strong acid + Strong base Neutral
Strong acid + Weak base Acidic
Weak acid + Strong base Basic
Neutral solution example
NaCl = Sodium chloride
HCl = H+ and Cl-
NaOH = Na+ and OH-
OH- = Strong Base
H+ = Strong Acid
Sodium chloride, formed from neutralization of HCl by NaOH.
NaOH + HCl = NaCl + H2O
NaCl in water is not acidic or basic, since it's ions cannot hydrolyze.
So formula would be XOH + YH = XY + H2O
Answer:
The full amount (5.00 g) will be dissolved in 1 L of water at 25°C.
Explanation:
The molecular weight (MW) of Vanillin (C₈H₈O₃) is calculated from the chemical formula as follows:
MW(C₈H₈O₃) = (12 g/mol x 8) + (1 g/mol x 8) + (16 g/mol x 3) = 152 g/mol
If 0.070 mol of C₈H₈O₃ are soluble per liter of water at 25°C, the maximum mass that can be dissolved in 1 L is:
0.070 mol x 152 g/mol = 10.64 g
Since 5.00 g is lesser than the maximum amount that can be dissolved (10.64 g), the added amount will be completely dissolved in 1 L of water at 25°C.
Answer:
1 mole.
Explanation:
Hello there!
2.5-1.5=1
Subtract the sucrose moles from the total moles, and there you are!
:)
Answer:
143 parts I think probably not
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
