Answer:
N=2
H=6
Explanation:
1.Balance a chemical equation in terms of moles.
2.Use the balanced equation to construct conversion factors in terms of moles.
3.Calculate moles of one substance from moles of another substance using a balanced chemical equation.
The law of conservation of matter says that matter cannot be created or destroyed. In chemical equations, the number of atoms of each element in the reactants must be the same as the number of atoms of each element in the products.
(P.s it could also be where you have to solve it in which you have to simplify it first then solve it.) like adding them all up.
Hope this is the answer. :)
From the graph. the answer is
A. supergiants
A. The balanced chemical reaction of Sodium metal and Water is 2Na + 2H₂O → 2NaOH + H₂.
<h3>What is a balanced chemical equation? </h3>
A balanced equation contains the same number of each type of atoms on both the left and right sides of the reaction arrow.
<h3>Reaction of Sodium metal and Water</h3>
Sodium metal reacts rapidly with water to form a colourless solution of sodium hydroxide (NaOH) and hydrogen gas (H2).
The balanced chemical reaction is written below;
2Na + 2H₂O → 2NaOH + H₂
Thus, the balanced chemical reaction of Sodium metal and Water is 2Na + 2H₂O → 2NaOH + H₂.
Learn more about chemical reaction here: brainly.com/question/11231920
#SPJ1
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
I think it is full because an atom is really small and can’t really be unreactive
