8/5lit.. of 12M NaOH
2/5lit.. of 2M NaOH
Answer:
chemical
Explanation:
Chemical weathering, which is the decomposition of a rock by the alteration of its chemical composition.
what?? please reword this
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Answer: Option (c) is the correct answer.
Explanation:
HF is a weak acid and not a strong acid. This is because fluorine is a highly electronegative atom and when it combines with a hydrogen atom then it will attract the valence electron of hydrogen atom more towards itself.
As a result, it will not dissociates easily to give hydrogen ion. Hence, it acts as a weak acid.
A neutralization reaction is defined as a reaction in which an acid reacts with a base to give salt and water. For example, 
It is true that, spectator ions "appear in the total ionic equation for a reaction, but not in the net ionic equation".
Titration is defined as a process in which concentration of an unknown solution is determined using a solution of known concentration.
Thus, we can conclude that the statement HF, HCl, and HNO3 are all examples of strong acids, is false.