Answer: Ionic bonds result from transfer of electrons, whereas covalent bonds are formed by sharing. ... Ionic bonds are electrostatic in nature, resulting from that attraction of positive and negative ions that result from the electron transfer process; charge separation between covalently bonded atoms is less extreme.
Explanation:
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Ⓑ Both plants and animals release energy from glucose/sugar in cellular respiration.
Your answer is radio waves
Answer:
the answer is 1:3:2
Hope this helps, let me know if you need any other help, Stoichiometry is hard
