we are given the reaction Cu + 2AgNO3 ---> Cu(NO3)2 + 2Ag. This means for every mole Cu used, there are 2 moles of Ag produced. In this case, given 31.75 g Cu, converting to moles through molar mass and using stoichiometric ratio and the molar mass of Ag, the mass Ag produced is 107.9 grams.
Answer:
John Dalton:
John Dalton was the scientist who introduced atomic theory in the field of chemistry. Dalton worked on different gases and formulated this theory. The main points of Dalton's theory are:
- Every element present is made up of atoms.
- Atoms of an elements are have the same same properties whereas these properties are different for each element.
- According to his theory, an atom could not be broken down.
- Different atoms combine or get separated from each other during a chemical reaction.
Ernest Rutherford:
Ernest Rutherford is known as the father of nuclear physics due to his impressing research work on radioactivity of atoms. Rutherford was the first scientist to discover the nucleus of an atom and prove that the nucleus was charged. He also described that the electrons circle around the nucleus of an atom.
Answer:
A decrease in [H3O+] and an increase in pH (option a)
Explanation:
Equilibrium of water is shown in this equation
2H₂O ⇄ H₃O⁺ + OH⁻
When you add NaOH, you are modifying [OH⁻]
NaOH → Na⁺ + OH⁻
In equilibrium of water, the [OH⁻] increases
2H₂O ⇄ ↓ H₃O⁺ + OH⁻ ↑
As the [OH⁻] increases, by Le Chatellier, the equilibrium tends to decrease [H₃O⁺].
If the [OH⁻] is higher, pH is also high so the solution of water and sodium hydroxide would be totally basic.
Arenal Volcano: Plate Tectonic Setting. The volcanic arc of Costa Rica, where Arenal is located, is a chain of mountains resulting from the subduction of the Cocos tectonic plate under the Caribbean Plate. Costa Rica is part of the Central American isthmus, which connects the North and South American continents.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
