A layer of hot liquid rock
The food we eat is can sometimes bo bad or good but it relates to the energy in our because it turns into energy and then we have strenght to do something and stay healthy.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
How does methane gas affect the environment?
If methane leaks into the air before being used — from a leaky pipe, for instance — it absorbs the sun's heat, warming the atmosphere. For this reason, it's considered a greenhouse gas, like carbon dioxide.
Explanation:
