Answer:
Explanation:
While trying to write the chemical formula for a compound (a neutral molecule), one must identify and exchange the charge of the cation with that of the anion to become the subscript of one other. For example
Aluminium oxide has Aluminium (Al) and oxygen (O); since Al has a charge of 3+ (the cation) and O has a charge of 2- (the anion), the compound would have it's charges as Al³⁺O²⁻ and when the charges are exchanged to there subscripts, it would form Al₂O₃; thus there would be two cations of aluminium for every three anions of oxygen in order to have a neutral molecule.
This same explanation can be given to Aluminium sulfite. Aluminium sulfite has Aluminium (Al) and sulfite (SO₃). Al has a charge of 3+ (cation) while sulfite has a charge of 2- (anion), with the compound having it's charges as Al³⁺(SO₃)²⁻ and when the charges are exchanged to there subscripts, it would form Al₂(SO₃)₃ and would thus have 2 cations of aluminium (Al³⁺) for every 3 anions of sulfite (SO₃³⁻) in order to have a neutral molecule.
Answer:
Sn^2+(aq)/Sn^3+(aq)//F2(g)/2F-(aq)
Explanation:
In writing the shorthand notation for an electrochemical cell, the oxidation half cell is shown on the left hand side and the reduction half cell is shown on the right hand side. The oxidation half equation reflects electron loss while the reduction half equation reflects electron gain.
Answer: Parts per million (ppm)
Explanation:
Consider the units milligram per milliliter. This gives us one part of the solute per one million parts of solvent. That is 10^ -3/10^-3= 10^-6. This unit is commonly used in analytical chemistry to show very small concentration of analyte. A similar unit is parts per billion(ppb)
The distance between (–6, 2) and (8, 10) on a coordinate grid is 8.246
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
