Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
2 Na + 2 H2O → 2 NaOH + H2 (balanced equation)
The answer would be 2, since 2 in the coefficient of both Na and NaOH
Answer:
Determine how many moles of CO2 are required to produce 11.0 mol of glucose,
i need points thanks for CO2moles
The highest atom economy
2CO + O₂ ⇒ 2CO₂
<h3>Further explanation</h3>
Given
The reaction for the production of CO₂
Required
The highest atom economy
Solution
In reactions, there are sometimes unwanted products that can be said to be a by-product or a waste product. Meanwhile, the desired product can be said to be a useful product, which can be shown as the atom economy
of the reaction
the higher the atomic economy value of a reaction, the smaller the waste/ byproducts produced, so that less energy is wasted
The general formula:
Atom economy = (mass of useful product : mass of all reactants/products) x 100
<em>or
</em>
Atom economy = (total formula masses of useful product : total formula masses of all reactants/products) x 100
So a reaction that only produces one product will have the highest atomic value, namely the reaction in option C
Answer:
option b is the correct answer
