Is this supposed to be a question?????
Answer:
the citric acid in lemon juice is a natural bleach, or oxidizing agent. It whitens hair by chemically reducing your hair's color pigment, or melanin. When exposed to the sun, the citric acid accelerates the bleaching process
It is know as the normal force.
When a solid is placed on a support, the latter exerts forces on the solid at each point of contact. These are forces that oppose the weight and prevent an object from falling.
This force is usually vertical and upward and often offsets the weight. If the solid is in equilibrium on the support the forces compensate the weight of the solid.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
</h2>