Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
First, you want to extract the negative from -log(x).
So now you have log(x) = -2
Now you have to use the property loga(x)=b is the same as x=a^2
So now, it is x = 10^-2. Remember that when there is just a log, it is implied that it is ‘a’ is 10.
Then you evaluate the negative square to 1/10^2
Answer is 1/100
Answer:
9.80 g
Explanation:
The molecular mass of the atoms mentioned in the question is as follows -
S = 32 g / mol
F = 19 g / mol
The molecular mass of the compound , SF₆ = 32 + ( 6 * 19 ) = 146 g / mol
The mass of 6 F = 6 * 19 = 114 g /mol .
The percentage of F in the compound =
mass of 6 F / total mass of the compound * 100
Hence ,
The percentage of F in the compound = 114 g /mol / 146 g / mol * 100
78.08 %
Hence , from the question ,
In 12.56 g of the compound ,
The grams of F = 0.7808 * 12.56 = 9.80 g
Explanation:
Ions form when atoms gain or lose electrons. This is so that they form a full outer shell of electrons. When an atom gains electrons it becomes a negative ion, because electrons are negatively charged. For example, all halogens (group 7 or 17) form negative ions as they gain an electron forming a 1- charge. When an atom loses electrons it becomes a positive ion, as it is losing some negative charge from the electrons. This would be for example, alkali metals (group 1) which lose an electron to form a positive ion with a 1+ charge, (ALL metals form positive ions).
The total mass would be 142.05 g/mol. Since sodium is 22.99 g/mol and there are 2 sodium atoms, it would be 45.98 g/mol. Divide 45.98 by 142.05 and you get 32.37%
