It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
I would believe the answer to this question is D. According to the concept of the tragedy of the commons, shared resources are used by more than one organism. Due to the large consumption of shared resources they start to be fewer and fewer in number and over time if we are not careful they will be depleted.
Answer: Step 1, Isomerase.
Explanation:
Form the version of palmitic acid in the step one by changing the double bond within alpha and beta carbon by Isomerase.
B and C are Isomers, the molecule only differ in configuration.
Answer:
Magnesium
0.003mole
Explanation:
The problem here entails we find the metal in the carbonate.
For group 2 member, let the metal = X;
The carbonate is XCO₃;
If we sum the atomic mass of the elements in the metal carbonate, we should arrive at 84g/mol
Atomic mass of C = 12g/mol
O = 16g/mol
Atomic mass of X + 12 + 3(16) = 84
Atomic mass of X = 84 - 60 = 24g/mol
The element with atomic mass of 24g is Magnesium
B.
Number of moles in 0.3g of CaCO₃:
Molar mass of CaCO₃ = 40 + 12 + 3(16) = 100g/mol
Number of moles =
Number of moles =
= 0.003mole