Answer:
It Is Considered The "negative" Electrode
Explanation:
An electrochemical cell is an electrolytic cell that drives a non-spontaneous redox reaction through the application of electrical energy. This cell is used to decompose chemical compounds, in a process called electrolysis. An electrode at which reduction take place is called the cathode. In reduction, electrons travel toward the site of reduction such that the negative charge is on the cathode.
Systems can exist in three ways as open systems, closed systems, and isolated systems. The main difference between open and closed system is that in an open system, matter can be exchanged with the surrounding whereas, in a closed system, matter cannot be exchanged with the surrounding.
btw why not just look it up on google? btw btw brainliest plz
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
8.6g/cm³ (BRASS)
Explanation:
Given the following :
Mass of object = 86g
Volume of object = 10cm³
The density of an object is calculated using the formula :
Density(g/cm³) = mass(g) / volume(cm³)
Inputting our values :
Density = 86g / 10cm³
Density = 8.6g/cm³
According to the table provided, the object which corresponds to having a density of 8.6g/cm³ is BRASS
Answer:
2.
Explanation:
When you put the paper in a solution, it will turn blue if it is basic, or red if it is acidic. If it does not change color, it is fairly neutral.
