Answer:
it should be y=6x
Step-by-step explanation:
Answer:cos(53), cos 53 degrees
Step-by-step explanation: sin(angle)= cos(90-angle)
sin(37)=cos(90-37)=cos(53)
It does not say simple or compound interest.
Simple interest is rarely used these days, so assume compound.
Use the standard formula:
future value = present value*(1+rate/n)^(nt)
n=number of times interest is compounded per year (=1)
t=number of years
Plugging values,
200=100(1.09)^t
1.09^t = 2
take log
t(log(1.09))=log 2
t=log(2)/log(1.09)=0.6931/0.08618=8.04 years.
I think the answer could be C
Answer:
Check below
Step-by-step explanation:
So 1 the relationship between the height of the tree and the time since it was planted is a set of unconnected points, since the tree eventually stops growing, it's not continuous.
2. The relationship is between the number of 12 dollar dvds and the total cost is a solid line, because you can buy an infinite amount of dvds so it's continuous.
3. The relationship between the height of a small child and the age of a small child recorded in months is a set of unconnected points. It's over the course of months, and he will eventually stop growing, so it's not continuos.